C18H14N4O7S — CID 23769984
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 23769984) has the molecular formula C18H14N4O7S and a molecular weight of 430.40 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 23769984 |
| Molecular Formula | C18H14N4O7S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2ncc([N+](=O)[O-])s2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H14N4O7S/c1-10-4-5-11(7-12(10)20-16(24)13-3-2-6-28-13)17(25)29-9-14(23)21-18-19-8-15(30-18)22(26)27/h2-8H,9H2,1H3,(H,20,24)(H,19,21,23) |
| InChIKey | SFCRFVWQZYTUGA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 153.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|