C15H8ClF2N3O3S2 — CID 5038841
5-chloro-N-[6-(difluoromethylsulfanyl)-1,3-benzothiazol-2-yl]-2-nitrobenzamide (PubChem CID 5038841) has the molecular formula C15H8ClF2N3O3S2 and a molecular weight of 415.83 g/mol. Its IUPAC name is 5-chloro-N-[6-(difluoromethylsulfanyl)-1,3-benzothiazol-2-yl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[6-(difluoromethylsulfanyl)-1,3-benzothiazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 5038841 |
| Molecular Formula | C15H8ClF2N3O3S2 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 5-chloro-N-[6-(difluoromethylsulfanyl)-1,3-benzothiazol-2-yl]-2-nitrobenzamide |
| SMILES | O=C(Nc1nc2ccc(SC(F)F)cc2s1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H8ClF2N3O3S2/c16-7-1-4-11(21(23)24)9(5-7)13(22)20-15-19-10-3-2-8(25-14(17)18)6-12(10)26-15/h1-6,14H,(H,19,20,22) |
| InChIKey | LVECYKXWAMEYDU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|