C16H9FN4O5S — CID 3500120
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide (PubChem CID 3500120) has the molecular formula C16H9FN4O5S and a molecular weight of 388.34 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3500120 |
| Molecular Formula | C16H9FN4O5S |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)cs1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9FN4O5S/c17-10-3-1-9(2-4-10)13-8-27-16(18-13)19-15(22)12-6-5-11(20(23)24)7-14(12)21(25)26/h1-8H,(H,18,19,22) |
| InChIKey | WOSDPOASRWDNAJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|