C25H16N4O4S3 — CID 3555955
5-nitro-N-[[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 3555955) has the molecular formula C25H16N4O4S3 and a molecular weight of 532.63 g/mol. Its IUPAC name is 5-nitro-N-[[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 5-nitro-N-[[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3555955 |
| Molecular Formula | C25H16N4O4S3 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 5-nitro-N-[[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc(-c2ccc(Oc3ccccc3)cc2)cs1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C25H16N4O4S3/c30-23(22-13-16-12-17(29(31)32)8-11-21(16)36-22)27-24(34)28-25-26-20(14-35-25)15-6-9-19(10-7-15)33-18-4-2-1-3-5-18/h1-14H,(H2,26,27,28,30,34) |
| InChIKey | DJWBQTLWVMFVNO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|