C21H13BrN4O4S2 — CID 3262748
N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 3262748) has the molecular formula C21H13BrN4O4S2 and a molecular weight of 529.40 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3262748 |
| Molecular Formula | C21H13BrN4O4S2 |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc(-c2ccc(Br)cc2)cs1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C21H13BrN4O4S2/c22-14-6-4-12(5-7-14)16-11-32-21(23-16)25-20(31)24-19(27)18-9-8-17(30-18)13-2-1-3-15(10-13)26(28)29/h1-11H,(H2,23,24,25,27,31) |
| InChIKey | RBGSWWWZLWZSLU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|