C20H12N4O5S2 — CID 23767725
N-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-oxochromene-3-carboxamide (PubChem CID 23767725) has the molecular formula C20H12N4O5S2 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 23767725 |
| Molecular Formula | C20H12N4O5S2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | N-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H12N4O5S2/c25-17(14-9-12-3-1-2-4-16(12)29-18(14)26)22-19(30)23-20-21-15(10-31-20)11-5-7-13(8-6-11)24(27)28/h1-10H,(H2,21,22,23,25,30) |
| InChIKey | UNGUEYAHRBRTQU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|