C17H11N3O3S3 — CID 7615198
N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 7615198) has the molecular formula C17H11N3O3S3 and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7615198 |
| Molecular Formula | C17H11N3O3S3 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CSc1cccc2sc(NC(=O)c3cc4cc([N+](=O)[O-])ccc4s3)nc12 |
| InChI | InChI=1S/C17H11N3O3S3/c1-24-12-3-2-4-13-15(12)18-17(26-13)19-16(21)14-8-9-7-10(20(22)23)5-6-11(9)25-14/h2-8H,1H3,(H,18,19,21) |
| InChIKey | JYTHKQNVOYRNCS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|