C21H31NO5 — CID 55307331
[2-(tert-butylamino)-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 55307331) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 55307331 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H31NO5/c1-5-6-7-14-26-17-10-8-16(9-11-17)18(23)12-13-20(25)27-15-19(24)22-21(2,3)4/h8-11H,5-7,12-15H2,1-4H3,(H,22,24) |
| InChIKey | NRZWPQNQVUVMPP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|