C15H14F3NO3 — CID 78841437
(5-oxopyrrolidin-2-yl)methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 78841437) has the molecular formula C15H14F3NO3 and a molecular weight of 313.27 g/mol. Its IUPAC name is (5-oxopyrrolidin-2-yl)methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | (5-oxopyrrolidin-2-yl)methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 78841437 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (5-oxopyrrolidin-2-yl)methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C1CCC(COC(=O)/C=C/c2cccc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C15H14F3NO3/c16-15(17,18)11-3-1-2-10(8-11)4-7-14(21)22-9-12-5-6-13(20)19-12/h1-4,7-8,12H,5-6,9H2,(H,19,20)/b7-4+ |
| InChIKey | HCIHMLMBPKHZRS-QPJJXVBHSA-N |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|