C19H25N3O2 — CID 131650729
[4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 131650729) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is [4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 131650729 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | [4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CN(Cc1ccco1)C1CCCC2CN(C(=O)c3ccc[nH]3)CC21 |
| InChI | InChI=1S/C19H25N3O2/c1-21(12-15-6-4-10-24-15)18-8-2-5-14-11-22(13-16(14)18)19(23)17-7-3-9-20-17/h3-4,6-7,9-10,14,16,18,20H,2,5,8,11-13H2,1H3 |
| InChIKey | YUYIWESOKHMODH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |