C15H23N3O2 — CID 133135799
(3aR,7aS)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 133135799) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (3aR,7aS)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aR,7aS)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 133135799 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (3aR,7aS)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | CN(Cc1ccco1)C1CCC[C@@H]2CN(C(N)=O)C[C@H]12 |
| InChI | InChI=1S/C15H23N3O2/c1-17(9-12-5-3-7-20-12)14-6-2-4-11-8-18(15(16)19)10-13(11)14/h3,5,7,11,13-14H,2,4,6,8-10H2,1H3,(H2,16,19)/t11-,13+,14?/m1/s1 |
| InChIKey | SUCJRMODYVKCOL-LXKBMQFRSA-N |
| XLogP | 1.89 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |