C13H20N2O2 — CID 116654269
N-(furan-2-ylmethyl)-N,3-dimethylpiperidine-1-carboxamide (PubChem CID 116654269) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N,3-dimethylpiperidine-1-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N,3-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 116654269 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-N,3-dimethylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)N(C)Cc2ccco2)C1 |
| InChI | InChI=1S/C13H20N2O2/c1-11-5-3-7-15(9-11)13(16)14(2)10-12-6-4-8-17-12/h4,6,8,11H,3,5,7,9-10H2,1-2H3 |
| InChIKey | PLSIHPYZYXCCIH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |