C15H25ClN2O2 — CID 119958310
N-(furan-2-ylmethyl)-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119958310) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119958310 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)N(C)Cc1ccco1)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H24N2O2.ClH/c1-12(13-5-7-16-8-6-13)10-15(18)17(2)11-14-4-3-9-19-14;/h3-4,9,12-13,16H,5-8,10-11H2,1-2H3;1H |
| InChIKey | SQUDTTYTJDVCBV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |