C17H25BrClFN2O — CID 119764793
N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119764793) has the molecular formula C17H25BrClFN2O and a molecular weight of 407.76 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119764793 |
| Molecular Formula | C17H25BrClFN2O |
| Molecular Weight | 407.76 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)N(C)Cc1cc(Br)ccc1F)C1CCNCC1.Cl |
| InChI | InChI=1S/C17H24BrFN2O.ClH/c1-12(13-5-7-20-8-6-13)9-17(22)21(2)11-14-10-15(18)3-4-16(14)19;/h3-4,10,12-13,20H,5-9,11H2,1-2H3;1H |
| InChIKey | WNOYAJSIVHAINZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |