C15H26Cl2N4O — CID 119867890
N-methyl-3-piperidin-4-yl-N-(pyrazin-2-ylmethyl)butanamide;dihydrochloride (PubChem CID 119867890) has the molecular formula C15H26Cl2N4O and a molecular weight of 349.31 g/mol. Its IUPAC name is N-methyl-3-piperidin-4-yl-N-(pyrazin-2-ylmethyl)butanamide;dihydrochloride.
| Compound Name | N-methyl-3-piperidin-4-yl-N-(pyrazin-2-ylmethyl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119867890 |
| Molecular Formula | C15H26Cl2N4O |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-methyl-3-piperidin-4-yl-N-(pyrazin-2-ylmethyl)butanamide;dihydrochloride |
| SMILES | CC(CC(=O)N(C)Cc1cnccn1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H24N4O.2ClH/c1-12(13-3-5-16-6-4-13)9-15(20)19(2)11-14-10-17-7-8-18-14;;/h7-8,10,12-13,16H,3-6,9,11H2,1-2H3;2*1H |
| InChIKey | FGFWGBIKUUQCHN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |