C13H23Cl2N5O — CID 120982556
3-[methyl(pyrazin-2-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride (PubChem CID 120982556) has the molecular formula C13H23Cl2N5O and a molecular weight of 336.27 g/mol. Its IUPAC name is 3-[methyl(pyrazin-2-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride.
| Compound Name | 3-[methyl(pyrazin-2-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120982556 |
| Molecular Formula | C13H23Cl2N5O |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-[methyl(pyrazin-2-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride |
| SMILES | CN(CCC(=O)N1CCNCC1)Cc1cnccn1.Cl.Cl |
| InChI | InChI=1S/C13H21N5O.2ClH/c1-17(11-12-10-15-3-4-16-12)7-2-13(19)18-8-5-14-6-9-18;;/h3-4,10,14H,2,5-9,11H2,1H3;2*1H |
| InChIKey | ADVAWMSIIOALQJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |