C12H23Cl2N5O — CID 120982759
3-[methyl(1H-pyrazol-5-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride (PubChem CID 120982759) has the molecular formula C12H23Cl2N5O and a molecular weight of 324.26 g/mol. Its IUPAC name is 3-[methyl(1H-pyrazol-5-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride.
| Compound Name | 3-[methyl(1H-pyrazol-5-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120982759 |
| Molecular Formula | C12H23Cl2N5O |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[methyl(1H-pyrazol-5-ylmethyl)amino]-1-piperazin-1-ylpropan-1-one;dihydrochloride |
| SMILES | CN(CCC(=O)N1CCNCC1)Cc1ccn[nH]1.Cl.Cl |
| InChI | InChI=1S/C12H21N5O.2ClH/c1-16(10-11-2-4-14-15-11)7-3-12(18)17-8-5-13-6-9-17;;/h2,4,13H,3,5-10H2,1H3,(H,14,15);2*1H |
| InChIKey | ZSFCQGKZXIIYED-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |