C15H29ClN2O — CID 119795382
N-methyl-N-pent-4-enyl-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119795382) has the molecular formula C15H29ClN2O and a molecular weight of 288.86 g/mol. Its IUPAC name is N-methyl-N-pent-4-enyl-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-methyl-N-pent-4-enyl-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119795382 |
| Molecular Formula | C15H29ClN2O |
| Molecular Weight | 288.86 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-methyl-N-pent-4-enyl-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | C=CCCCN(C)C(=O)CC(C)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H28N2O.ClH/c1-4-5-6-11-17(3)15(18)12-13(2)14-7-9-16-10-8-14;/h4,13-14,16H,1,5-12H2,2-3H3;1H |
| InChIKey | CJMKCJBCOIBPRE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.86 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|