C21H27N3O2 — CID 124520110
[(3aS,4S,7aR)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-methyl-3-pyridinyl)methanone (PubChem CID 124520110) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is [(3aS,4S,7aR)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-methyl-3-pyridinyl)methanone.
| Compound Name | [(3aS,4S,7aR)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 124520110 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [(3aS,4S,7aR)-4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-methyl-3-pyridinyl)methanone |
| SMILES | Cc1cncc(C(=O)N2C[C@@H]3CCC[C@H](N(C)Cc4ccco4)[C@@H]3C2)c1 |
| InChI | InChI=1S/C21H27N3O2/c1-15-9-17(11-22-10-15)21(25)24-12-16-5-3-7-20(19(16)14-24)23(2)13-18-6-4-8-26-18/h4,6,8-11,16,19-20H,3,5,7,12-14H2,1-2H3/t16-,19+,20-/m0/s1 |
| InChIKey | ZYPHREITWGMBIL-DBVUQKKJSA-N |
| XLogP | 3.36 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |