C20H25N5O — CID 97458255
[(3aR,4R,7aS)-4-[methyl(pyridin-2-ylmethyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridazin-4-ylmethanone (PubChem CID 97458255) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3aR,4R,7aS)-4-[methyl(pyridin-2-ylmethyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(3aR,4R,7aS)-4-[methyl(pyridin-2-ylmethyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 97458255 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | [(3aR,4R,7aS)-4-[methyl(pyridin-2-ylmethyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridazin-4-ylmethanone |
| SMILES | CN(Cc1ccccn1)[C@@H]1CCC[C@@H]2CN(C(=O)c3ccnnc3)C[C@@H]21 |
| InChI | InChI=1S/C20H25N5O/c1-24(13-17-6-2-3-9-21-17)19-7-4-5-16-12-25(14-18(16)19)20(26)15-8-10-22-23-11-15/h2-3,6,8-11,16,18-19H,4-5,7,12-14H2,1H3/t16-,18+,19-/m1/s1 |
| InChIKey | ZMYHCXLDAQKRPN-NZSAHSFTSA-N |
| XLogP | 2.24 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |