C20H25N3O2 — CID 131653387
[4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-2-ylmethanone (PubChem CID 131653387) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 131653387 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [4-[furan-2-ylmethyl(methyl)amino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-2-ylmethanone |
| SMILES | CN(Cc1ccco1)C1CCCC2CN(C(=O)c3ccccn3)CC21 |
| InChI | InChI=1S/C20H25N3O2/c1-22(13-16-7-5-11-25-16)19-9-4-6-15-12-23(14-17(15)19)20(24)18-8-2-3-10-21-18/h2-3,5,7-8,10-11,15,17,19H,4,6,9,12-14H2,1H3 |
| InChIKey | TVANRJKGPVDAOX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |