C18H26N4O3S — CID 131643858
N-(furan-2-ylmethyl)-N-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine (PubChem CID 131643858) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
|---|---|
| PubChem CID | 131643858 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine |
| SMILES | CN(Cc1ccco1)C1CCCC2CN(S(=O)(=O)c3cn(C)cn3)CC21 |
| InChI | InChI=1S/C18H26N4O3S/c1-20-12-18(19-13-20)26(23,24)22-9-14-5-3-7-17(16(14)11-22)21(2)10-15-6-4-8-25-15/h4,6,8,12-14,16-17H,3,5,7,9-11H2,1-2H3 |
| InChIKey | PRSAGFLWOVQIAT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |