C15H26N4O3S — CID 172655559
(3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 172655559) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 172655559 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CO[C@@H]1C[C@H]2CN(S(=O)(=O)c3cn(C)cn3)C[C@H]2C[C@H]1N(C)C |
| InChI | InChI=1S/C15H26N4O3S/c1-17(2)13-5-11-7-19(8-12(11)6-14(13)22-4)23(20,21)15-9-18(3)10-16-15/h9-14H,5-8H2,1-4H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | ZUTSNUWGQBMOEN-XJFOESAGSA-N |
| XLogP | 0.40 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |