C11H17N3O3S — CID 97369174
(2R,3aS,6aS)-2-methyl-5-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 97369174) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2R,3aS,6aS)-2-methyl-5-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (2R,3aS,6aS)-2-methyl-5-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 97369174 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R,3aS,6aS)-2-methyl-5-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | C[C@@H]1C[C@H]2CN(S(=O)(=O)c3cn(C)cn3)C[C@H]2O1 |
| InChI | InChI=1S/C11H17N3O3S/c1-8-3-9-4-14(5-10(9)17-8)18(15,16)11-6-13(2)7-12-11/h6-10H,3-5H2,1-2H3/t8-,9+,10-/m1/s1 |
| InChIKey | RONDIFJKVJFHMT-KXUCPTDWSA-N |
| XLogP | 0.22 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |