C12H19N5O3S — CID 124812375
(9aR)-8-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 124812375) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (9aR)-8-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | (9aR)-8-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 124812375 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (9aR)-8-methyl-2-(1-methylimidazol-4-yl)sulfonyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(S(=O)(=O)c3cn(C)cn3)C[C@@H]2C1=O |
| InChI | InChI=1S/C12H19N5O3S/c1-14-8-11(13-9-14)21(19,20)17-6-5-16-4-3-15(2)12(18)10(16)7-17/h8-10H,3-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | VRXCEPASZVWCDB-SNVBAGLBSA-N |
| XLogP | -1.43 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |