C24H44N4O4S — CID 90405062
(3R,4S)-4-(1,3-dioxan-2-yl)-N,N-dihexyl-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine (PubChem CID 90405062) has the molecular formula C24H44N4O4S and a molecular weight of 484.71 g/mol. Its IUPAC name is (3R,4S)-4-(1,3-dioxan-2-yl)-N,N-dihexyl-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3R,4S)-4-(1,3-dioxan-2-yl)-N,N-dihexyl-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 90405062 |
| Molecular Formula | C24H44N4O4S |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | (3R,4S)-4-(1,3-dioxan-2-yl)-N,N-dihexyl-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
| SMILES | CCCCCCN(CCCCCC)[C@H]1CN(S(=O)(=O)c2cn(C)cn2)C[C@@H]1C1OCCCO1 |
| InChI | InChI=1S/C24H44N4O4S/c1-4-6-8-10-13-27(14-11-9-7-5-2)22-18-28(17-21(22)24-31-15-12-16-32-24)33(29,30)23-19-26(3)20-25-23/h19-22,24H,4-18H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | IUJPSFAICSVBEF-VXKWHMMOSA-N |
| XLogP | 3.63 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|