C18H24N2O — CID 175654870
1-[(3aR,4R,7aS)-4-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methylprop-2-en-1-one (PubChem CID 175654870) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[(3aR,4R,7aS)-4-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[(3aR,4R,7aS)-4-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 175654870 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-[(3aR,4R,7aS)-4-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1C[C@H]2CCC[C@H](Cc3ccccn3)[C@H]2C1 |
| InChI | InChI=1S/C18H24N2O/c1-13(2)18(21)20-11-15-7-5-6-14(17(15)12-20)10-16-8-3-4-9-19-16/h3-4,8-9,14-15,17H,1,5-7,10-12H2,2H3/t14-,15-,17-/m1/s1 |
| InChIKey | RZBGHVKMKKXYNY-BFYDXBDKSA-N |
| XLogP | 3.07 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|