C11H16N2 — CID 96630031
cis-(1R,2S)-2-(pyridin-2-ylmethyl)cyclopentan-1-amine (PubChem CID 96630031) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is cis-(1R,2S)-2-(pyridin-2-ylmethyl)cyclopentan-1-amine.
| Compound Name | cis-(1R,2S)-2-(pyridin-2-ylmethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 96630031 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | cis-(1R,2S)-2-(pyridin-2-ylmethyl)cyclopentan-1-amine |
| SMILES | N[C@@H]1CCC[C@H]1Cc1ccccn1 |
| InChI | InChI=1S/C11H16N2/c12-11-6-3-4-9(11)8-10-5-1-2-7-13-10/h1-2,5,7,9,11H,3-4,6,8,12H2/t9-,11+/m0/s1 |
| InChIKey | IOCKHCWEKLAZAB-GXSJLCMTSA-N |
| XLogP | 1.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |