C10H15N2+ — CID 7047988
2-[[(2S)-pyrrolidin-1-ium-2-yl]methyl]pyridine (PubChem CID 7047988) has the molecular formula C10H15N2+ and a molecular weight of 163.24 g/mol. Its IUPAC name is 2-[[(2S)-pyrrolidin-1-ium-2-yl]methyl]pyridine.
| Compound Name | 2-[[(2S)-pyrrolidin-1-ium-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 7047988 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 2-[[(2S)-pyrrolidin-1-ium-2-yl]methyl]pyridine |
| SMILES | c1ccc(C[C@@H]2CCC[NH2+]2)nc1 |
| InChI | InChI=1S/C10H14N2/c1-2-6-11-9(4-1)8-10-5-3-7-12-10/h1-2,4,6,10,12H,3,5,7-8H2/p+1/t10-/m0/s1 |
| InChIKey | HAPUOOBIEAPWAZ-JTQLQIEISA-O |
| XLogP | 0.35 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |