C14H22NP — CID 10125220
2-[[(1S,2R)-1-tert-butylphospholan-2-yl]methyl]pyridine (PubChem CID 10125220) has the molecular formula C14H22NP and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[[(1S,2R)-1-tert-butylphospholan-2-yl]methyl]pyridine.
| Compound Name | 2-[[(1S,2R)-1-tert-butylphospholan-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 10125220 |
| Molecular Formula | C14H22NP |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 2-[[(1S,2R)-1-tert-butylphospholan-2-yl]methyl]pyridine |
| SMILES | CC(C)(C)[P@@]1CCC[C@@H]1Cc1ccccn1 |
| InChI | InChI=1S/C14H22NP/c1-14(2,3)16-10-6-8-13(16)11-12-7-4-5-9-15-12/h4-5,7,9,13H,6,8,10-11H2,1-3H3/t13-,16+/m1/s1 |
| InChIKey | SCLLHZKFWDPYOC-CJNGLKHVSA-N |
| XLogP | 4.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|