C11H16Cl2N2O2 — CID 89235530
(2S)-3-(pyridin-2-ylmethyl)pyrrolidine-2-carboxylic acid;dihydrochloride (PubChem CID 89235530) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is (2S)-3-(pyridin-2-ylmethyl)pyrrolidine-2-carboxylic acid;dihydrochloride.
| Compound Name | (2S)-3-(pyridin-2-ylmethyl)pyrrolidine-2-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 89235530 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2S)-3-(pyridin-2-ylmethyl)pyrrolidine-2-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)[C@H]1NCCC1Cc1ccccn1 |
| InChI | InChI=1S/C11H14N2O2.2ClH/c14-11(15)10-8(4-6-13-10)7-9-3-1-2-5-12-9;;/h1-3,5,8,10,13H,4,6-7H2,(H,14,15);2*1H/t8?,10-;;/m0../s1 |
| InChIKey | ORAHXRHKJMHWQL-ZHLJYLQZSA-N |
| XLogP | 1.53 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |