C18H24N4 — CID 70873996
1-N,1-N-bis(pyridin-2-ylmethyl)cyclohexane-1,3-diamine (PubChem CID 70873996) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 1-N,1-N-bis(pyridin-2-ylmethyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N,1-N-bis(pyridin-2-ylmethyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 70873996 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1-N,1-N-bis(pyridin-2-ylmethyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(N(Cc2ccccn2)Cc2ccccn2)C1 |
| InChI | InChI=1S/C18H24N4/c19-15-6-5-9-18(12-15)22(13-16-7-1-3-10-20-16)14-17-8-2-4-11-21-17/h1-4,7-8,10-11,15,18H,5-6,9,12-14,19H2 |
| InChIKey | ILMLLEKLVOKWBE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |