C19H23F2N3 — CID 129475727
(4R)-N-[(2,5-difluorophenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine (PubChem CID 129475727) has the molecular formula C19H23F2N3 and a molecular weight of 331.41 g/mol. Its IUPAC name is (4R)-N-[(2,5-difluorophenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine.
| Compound Name | (4R)-N-[(2,5-difluorophenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 129475727 |
| Molecular Formula | C19H23F2N3 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (4R)-N-[(2,5-difluorophenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine |
| SMILES | Fc1ccc(F)c(CN(Cc2ccccn2)[C@@H]2CCCNCC2)c1 |
| InChI | InChI=1S/C19H23F2N3/c20-16-6-7-19(21)15(12-16)13-24(14-17-4-1-2-10-23-17)18-5-3-9-22-11-8-18/h1-2,4,6-7,10,12,18,22H,3,5,8-9,11,13-14H2/t18-/m1/s1 |
| InChIKey | LWHIFMUCFIOCKI-GOSISDBHSA-N |
| XLogP | 3.50 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |