C19H30ClN5 — CID 120844953
N-[(2-propan-2-ylpyrazol-3-yl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride (PubChem CID 120844953) has the molecular formula C19H30ClN5 and a molecular weight of 363.94 g/mol. Its IUPAC name is N-[(2-propan-2-ylpyrazol-3-yl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride.
| Compound Name | N-[(2-propan-2-ylpyrazol-3-yl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120844953 |
| Molecular Formula | C19H30ClN5 |
| Molecular Weight | 363.94 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-[(2-propan-2-ylpyrazol-3-yl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride |
| SMILES | CC(C)n1nccc1CN(Cc1ccccn1)C1CCCNCC1.Cl |
| InChI | InChI=1S/C19H29N5.ClH/c1-16(2)24-19(9-13-22-24)15-23(14-17-6-3-4-11-21-17)18-7-5-10-20-12-8-18;/h3-4,6,9,11,13,16,18,20H,5,7-8,10,12,14-15H2,1-2H3;1H |
| InChIKey | CDTWGTFFSCWLTB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |