C20H28ClN3 — CID 129004801
N-[(3-methylphenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride (PubChem CID 129004801) has the molecular formula C20H28ClN3 and a molecular weight of 345.92 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride.
| Compound Name | N-[(3-methylphenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 129004801 |
| Molecular Formula | C20H28ClN3 |
| Molecular Weight | 345.92 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-N-(pyridin-2-ylmethyl)azepan-4-amine;hydrochloride |
| SMILES | Cc1cccc(CN(Cc2ccccn2)C2CCCNCC2)c1.Cl |
| InChI | InChI=1S/C20H27N3.ClH/c1-17-6-4-7-18(14-17)15-23(16-19-8-2-3-12-22-19)20-9-5-11-21-13-10-20;/h2-4,6-8,12,14,20-21H,5,9-11,13,15-16H2,1H3;1H |
| InChIKey | JPEIAHAGOSUCDS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |