C14H23N3 — CID 43137570
N'-cyclopentyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine (PubChem CID 43137570) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N'-cyclopentyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-cyclopentyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 43137570 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N'-cyclopentyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine |
| SMILES | NCCCN(Cc1ccccn1)C1CCCC1 |
| InChI | InChI=1S/C14H23N3/c15-9-5-11-17(14-7-1-2-8-14)12-13-6-3-4-10-16-13/h3-4,6,10,14H,1-2,5,7-9,11-12,15H2 |
| InChIKey | CPPPXJCCNCFUMP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |