C12H19N3 — CID 102874472
N'-cyclobutyl-N'-pyridin-2-ylpropane-1,3-diamine (PubChem CID 102874472) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N'-cyclobutyl-N'-pyridin-2-ylpropane-1,3-diamine.
| Compound Name | N'-cyclobutyl-N'-pyridin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102874472 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N'-cyclobutyl-N'-pyridin-2-ylpropane-1,3-diamine |
| SMILES | NCCCN(c1ccccn1)C1CCC1 |
| InChI | InChI=1S/C12H19N3/c13-8-4-10-15(11-5-3-6-11)12-7-1-2-9-14-12/h1-2,7,9,11H,3-6,8,10,13H2 |
| InChIKey | PUVBHERYRXRMKS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |