About N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine
N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine (PubChem CID 43137168) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine |
| PubChem CID | 43137168 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine |
| SMILES | NCCCN(c1ccncc1)C1CCCCC1 |
| InChI | InChI=1S/C14H23N3/c15-9-4-12-17(13-5-2-1-3-6-13)14-7-10-16-11-8-14/h7-8,10-11,13H,1-6,9,12,15H2 |
| InChIKey | QVVIJVHOKZGRAR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine?
The IUPAC name of N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine (CID 43137168) is N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine.
What is the SMILES notation for N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine?
The canonical SMILES for N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine is NCCCN(c1ccncc1)C1CCCCC1.
What is the InChIKey of N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine?
The InChIKey is QVVIJVHOKZGRAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3/c15-9-4-12-17(13-5-2-1-3-6-13)14-7-10-16-11-8-14/h7-8,10-11,13H,1-6,9,12,15H2.
What are the key properties of N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine?
N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine has a molecular weight of 233.36 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-N'-pyridin-4-ylpropane-1,3-diamine is sourced from PubChem (CID 43137168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).