C17H24N4 — CID 114788671
N'-cyclohexyl-N'-quinazolin-2-ylpropane-1,3-diamine (PubChem CID 114788671) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N'-cyclohexyl-N'-quinazolin-2-ylpropane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-quinazolin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114788671 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N'-cyclohexyl-N'-quinazolin-2-ylpropane-1,3-diamine |
| SMILES | NCCCN(c1ncc2ccccc2n1)C1CCCCC1 |
| InChI | InChI=1S/C17H24N4/c18-11-6-12-21(15-8-2-1-3-9-15)17-19-13-14-7-4-5-10-16(14)20-17/h4-5,7,10,13,15H,1-3,6,8-9,11-12,18H2 |
| InChIKey | YRIXSFPHZPDPGQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |