C12H19IN4 — CID 116648233
N'-cyclopentyl-N'-(5-iodopyrimidin-2-yl)propane-1,3-diamine (PubChem CID 116648233) has the molecular formula C12H19IN4 and a molecular weight of 346.22 g/mol. Its IUPAC name is N'-cyclopentyl-N'-(5-iodopyrimidin-2-yl)propane-1,3-diamine.
| Compound Name | N'-cyclopentyl-N'-(5-iodopyrimidin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116648233 |
| Molecular Formula | C12H19IN4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N'-cyclopentyl-N'-(5-iodopyrimidin-2-yl)propane-1,3-diamine |
| SMILES | NCCCN(c1ncc(I)cn1)C1CCCC1 |
| InChI | InChI=1S/C12H19IN4/c13-10-8-15-12(16-9-10)17(7-3-6-14)11-4-1-2-5-11/h8-9,11H,1-7,14H2 |
| InChIKey | MCNGEFUCQQDZCN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|