C13H18N4 — CID 114788666
N'-ethyl-N'-quinazolin-2-ylpropane-1,3-diamine (PubChem CID 114788666) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is N'-ethyl-N'-quinazolin-2-ylpropane-1,3-diamine.
| Compound Name | N'-ethyl-N'-quinazolin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114788666 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N'-ethyl-N'-quinazolin-2-ylpropane-1,3-diamine |
| SMILES | CCN(CCCN)c1ncc2ccccc2n1 |
| InChI | InChI=1S/C13H18N4/c1-2-17(9-5-8-14)13-15-10-11-6-3-4-7-12(11)16-13/h3-4,6-7,10H,2,5,8-9,14H2,1H3 |
| InChIKey | FRVZGXMFIFFEDM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |