C16H21N3 — CID 55174769
N'-cyclopropyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine (PubChem CID 55174769) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is N'-cyclopropyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine.
| Compound Name | N'-cyclopropyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 55174769 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N'-cyclopropyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine |
| SMILES | Cc1cc2ccccc2nc1N(CCCN)C1CC1 |
| InChI | InChI=1S/C16H21N3/c1-12-11-13-5-2-3-6-15(13)18-16(12)19(10-4-9-17)14-7-8-14/h2-3,5-6,11,14H,4,7-10,17H2,1H3 |
| InChIKey | LVHHYKQSXPIMAN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |