C14H19N3O — CID 102874494
N'-(1,3-benzoxazol-2-yl)-N'-cyclobutylpropane-1,3-diamine (PubChem CID 102874494) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N'-(1,3-benzoxazol-2-yl)-N'-cyclobutylpropane-1,3-diamine.
| Compound Name | N'-(1,3-benzoxazol-2-yl)-N'-cyclobutylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102874494 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N'-(1,3-benzoxazol-2-yl)-N'-cyclobutylpropane-1,3-diamine |
| SMILES | NCCCN(c1nc2ccccc2o1)C1CCC1 |
| InChI | InChI=1S/C14H19N3O/c15-9-4-10-17(11-5-3-6-11)14-16-12-7-1-2-8-13(12)18-14/h1-2,7-8,11H,3-6,9-10,15H2 |
| InChIKey | AIGZAPCMUHEIJO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |