C10H15N3 — CID 63759399
N'-cyclopropyl-N'-pyridin-4-ylethane-1,2-diamine (PubChem CID 63759399) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N'-cyclopropyl-N'-pyridin-4-ylethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N'-pyridin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63759399 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N'-cyclopropyl-N'-pyridin-4-ylethane-1,2-diamine |
| SMILES | NCCN(c1ccncc1)C1CC1 |
| InChI | InChI=1S/C10H15N3/c11-5-8-13(9-1-2-9)10-3-6-12-7-4-10/h3-4,6-7,9H,1-2,5,8,11H2 |
| InChIKey | RYTGLZULGLNIPW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |