C25H29F7N2O6 — CID 127023606
(4aS,8R,8aS)-6-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023606) has the molecular formula C25H29F7N2O6 and a molecular weight of 586.50 g/mol. Its IUPAC name is (4aS,8R,8aS)-6-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,8R,8aS)-6-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023606 |
| Molecular Formula | C25H29F7N2O6 |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | (4aS,8R,8aS)-6-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(Cc1ccco1)[C@@H]1CN(Cc2ccc(F)cc2)C[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H27FN2O2.2C2HF3O2/c1-23(14-19-5-3-10-25-19)20-15-24(12-16-6-8-18(22)9-7-16)13-17-4-2-11-26-21(17)20;2*3-2(4,5)1(6)7/h3,5-10,17,20-21H,2,4,11-15H2,1H3;2*(H,6,7)/t17-,20+,21-;;/m0../s1 |
| InChIKey | MOPHMMNCXDYOPB-ZGDAUWRFSA-N |
| XLogP | 4.80 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |