C23H32F6N4O5 — CID 155827997
(4aS,8R,8aS)-6-cyclopentyl-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827997) has the molecular formula C23H32F6N4O5 and a molecular weight of 558.52 g/mol. Its IUPAC name is (4aS,8R,8aS)-6-cyclopentyl-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,8R,8aS)-6-cyclopentyl-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827997 |
| Molecular Formula | C23H32F6N4O5 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (4aS,8R,8aS)-6-cyclopentyl-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(Cc1cncnc1)[C@@H]1CN(C2CCCC2)C[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N4O.2C2HF3O2/c1-22(11-15-9-20-14-21-10-15)18-13-23(17-6-2-3-7-17)12-16-5-4-8-24-19(16)18;2*3-2(4,5)1(6)7/h9-10,14,16-19H,2-8,11-13H2,1H3;2*(H,6,7)/t16-,18+,19-;;/m0../s1 |
| InChIKey | VHGMXOKVPJPBQC-XFFDLPHBSA-N |
| XLogP | 3.60 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |