C20H28F3N3O4 — CID 155839772
(3aR,7aS)-4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155839772) has the molecular formula C20H28F3N3O4 and a molecular weight of 431.46 g/mol. Its IUPAC name is (3aR,7aS)-4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aS)-4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839772 |
| Molecular Formula | C20H28F3N3O4 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (3aR,7aS)-4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(CN(C)C2CCC[C@@H]3CN(C(N)=O)C[C@H]23)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O2.C2HF3O2/c1-20(10-13-5-3-7-15(9-13)23-2)17-8-4-6-14-11-21(18(19)22)12-16(14)17;3-2(4,5)1(6)7/h3,5,7,9,14,16-17H,4,6,8,10-12H2,1-2H3,(H2,19,22);(H,6,7)/t14-,16+,17?;/m1./s1 |
| InChIKey | AAYWLPATTHUAFH-GTIOEJKOSA-N |
| XLogP | 2.94 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |