C21H28N4O2 — CID 131690076
[4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 131690076) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is [4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 131690076 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [4-[(3-methoxyphenyl)methyl-methylamino]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | COc1cccc(CN(C)C2CCCC3CN(C(=O)c4ccn[nH]4)CC32)c1 |
| InChI | InChI=1S/C21H28N4O2/c1-24(12-15-5-3-7-17(11-15)27-2)20-8-4-6-16-13-25(14-18(16)20)21(26)19-9-10-22-23-19/h3,5,7,9-11,16,18,20H,4,6,8,12-14H2,1-2H3,(H,22,23) |
| InChIKey | CIFNSFBCMTYHIH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |