C13H17N3O3 — CID 129429529
methyl (3S,3aS,6aR)-2-(1H-pyrazole-5-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 129429529) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl (3S,3aS,6aR)-2-(1H-pyrazole-5-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (3S,3aS,6aR)-2-(1H-pyrazole-5-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 129429529 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl (3S,3aS,6aR)-2-(1H-pyrazole-5-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C13H17N3O3/c1-19-13(18)11-9-4-2-3-8(9)7-16(11)12(17)10-5-6-14-15-10/h5-6,8-9,11H,2-4,7H2,1H3,(H,14,15)/t8-,9-,11-/m0/s1 |
| InChIKey | VJOUVVBIGIFTDL-QXEWZRGKSA-N |
| XLogP | 0.82 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |