C17H24N2O4 — CID 154744659
2-[3-[(3-methoxyphenyl)methyl-methylamino]-2-oxoazepan-1-yl]acetic acid (PubChem CID 154744659) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[3-[(3-methoxyphenyl)methyl-methylamino]-2-oxoazepan-1-yl]acetic acid.
| Compound Name | 2-[3-[(3-methoxyphenyl)methyl-methylamino]-2-oxoazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 154744659 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[3-[(3-methoxyphenyl)methyl-methylamino]-2-oxoazepan-1-yl]acetic acid |
| SMILES | COc1cccc(CN(C)C2CCCCN(CC(=O)O)C2=O)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-18(11-13-6-5-7-14(10-13)23-2)15-8-3-4-9-19(17(15)22)12-16(20)21/h5-7,10,15H,3-4,8-9,11-12H2,1-2H3,(H,20,21) |
| InChIKey | RQXOWZIWTIRYCZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |